
CAS 124756-24-7
:4,4-Diethyl-2-(3,4,5-trimethoxybenzoyl)-3,5-isoxazolidinedione
Description:
4,4-Diethyl-2-(3,4,5-trimethoxybenzoyl)-3,5-isoxazolidinedione, identified by its CAS number 124756-24-7, is a synthetic organic compound characterized by its unique isoxazolidinedione structure. This compound features a diethyl substitution at the 4,4-positions and a benzoyl group that is further substituted with three methoxy groups at the 3, 4, and 5 positions of the aromatic ring. The presence of the isoxazolidinedione moiety suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its ability to interact with biological targets. The methoxy groups enhance the compound's lipophilicity, potentially influencing its bioavailability and pharmacokinetic properties. Additionally, the compound may exhibit interesting chemical reactivity due to the presence of both the carbonyl and isoxazolidine functionalities, making it a candidate for further research in organic synthesis and drug development. Overall, this compound's structural features suggest a promising profile for various applications in chemistry and pharmacology.
Formula:C17H21NO7
InChI:InChI=1S/C17H21NO7/c1-6-17(7-2)15(20)18(25-16(17)21)14(19)10-8-11(22-3)13(24-5)12(9-10)23-4/h8-9H,6-7H2,1-5H3
InChI key:InChIKey=RSRCCEHOSDDIPD-UHFFFAOYSA-N
SMILES:C(C)C1(CC)C(=O)N(C(=O)C2=CC(OC)=C(OC)C(OC)=C2)OC1=O
Synonyms:- 4,4-Diethyl-2-(3,4,5-trimethoxybenzoyl)-3,5-isoxazolidinedione
- 3,5-Isoxazolidinedione, 4,4-diethyl-2-(3,4,5-trimethoxybenzoyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
3,5-Isoxazolidinedione, 4,4-diethyl-2-(3,4,5-trimethoxybenzoyl)-
CAS:Formula:C17H21NO7Molecular weight:351.3511
