
CAS 124756-59-8
:Boric acid (H3BO3), compd. with 2-(2-aminoethoxy)ethanol (1:1)
Description:
Boric acid (H3BO3) is a weak acid that exhibits antiseptic, insecticidal, and antifungal properties, commonly used in various applications, including pharmaceuticals and agriculture. When combined with 2-(2-aminoethoxy)ethanol in a 1:1 ratio, the resulting compound may exhibit enhanced solubility and bioactivity due to the presence of the aminoethoxy group, which can facilitate interactions with biological systems. The CAS number 124756-59-8 identifies this specific compound, indicating its unique chemical identity. The presence of the amino group suggests potential for hydrogen bonding and increased reactivity, which may enhance its efficacy in various applications, such as drug formulation or as a biochemical agent. Additionally, the compound may exhibit specific physical properties, such as solubility in water and potential stability under various conditions, making it suitable for diverse industrial and research purposes. Overall, the combination of boric acid with 2-(2-aminoethoxy)ethanol creates a compound with unique characteristics that may be leveraged in both scientific and practical applications.
Formula:C4H11NO2·BH3O3
InChI:InChI=1S/C4H11NO2.BH3O3/c5-1-3-7-4-2-6;2-1(3)4/h6H,1-5H2;2-4H
InChI key:InChIKey=KFWKUKKJYWCDBX-UHFFFAOYSA-N
SMILES:B(O)(O)O.O(CCN)CCO
Synonyms:- Ethanol, 2-(2-aminoethoxy)-, compd. with boric acid (H3BO3) (1:1)
- Boric acid (H3BO3), compd. with 2-(2-aminoethoxy)ethanol (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Boric acid (H3bo3), compd. with 2-(2-aminoethoxy)ethanol (1
CAS:Formula:C4H14BNO5Molecular weight:166.9687
