CymitQuimica logo

CAS 1247577-77-0

:

1-[[(1,2-Dimethylbutyl)amino]methyl]cyclohexanol

Description:
1-[[(1,2-Dimethylbutyl)amino]methyl]cyclohexanol, identified by its CAS number 1247577-77-0, is a chemical compound characterized by its unique structure that includes a cyclohexanol moiety and an amino group attached to a branched alkyl chain. This compound typically exhibits properties associated with both alcohols and amines, such as potential solubility in polar solvents and the ability to participate in hydrogen bonding due to the hydroxyl (-OH) group. The presence of the dimethylbutyl group may impart hydrophobic characteristics, influencing its overall solubility and reactivity. Additionally, the compound may exhibit biological activity, making it of interest in pharmaceutical and chemical research. Its specific applications and behavior in various chemical environments would depend on factors such as pH, temperature, and the presence of other reactive species. As with many organic compounds, safety data and handling precautions should be considered, particularly regarding its potential toxicity and environmental impact.
Formula:C13H27NO
InChI:InChI=1S/C13H27NO/c1-4-11(2)12(3)14-10-13(15)8-6-5-7-9-13/h11-12,14-15H,4-10H2,1-3H3
InChI key:InChIKey=LMIRCVYVJBRIFY-UHFFFAOYSA-N
SMILES:C(NC(C(CC)C)C)C1(O)CCCCC1
Synonyms:
  • 1-[[(1,2-Dimethylbutyl)amino]methyl]cyclohexanol
  • Cyclohexanol, 1-[[(1,2-dimethylbutyl)amino]methyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.