CAS 1247705-36-7

2-[[(4-Fluorophenyl)thio]methyl]piperidine

Description:

2-[[(4-Fluorophenyl)thio]methyl]piperidine is a chemical compound characterized by its piperidine core, which is a six-membered saturated nitrogen-containing ring. The presence of a thioether group, specifically a sulfur atom bonded to a methyl group and a 4-fluorophenyl moiety, contributes to its unique properties. The fluorine atom on the phenyl ring can influence the compound's electronic characteristics, potentially enhancing its lipophilicity and affecting its biological activity. This compound may exhibit interesting pharmacological properties, making it of interest in medicinal chemistry. Its structure suggests potential interactions with biological targets, which could be explored in drug development. Additionally, the compound's stability, solubility, and reactivity can be influenced by the substituents on the piperidine and phenyl rings. As with many organic compounds, safety and handling precautions should be observed, particularly due to the presence of the fluorine atom and sulfur, which may pose specific hazards. Overall, 2-[[(4-Fluorophenyl)thio]methyl]piperidine represents a class of compounds that may have significant implications in various chemical and pharmaceutical applications.

Formula: C₁₂H₁₆FNS

InChI: InChI=1S/C12H16FNS/c13-10-4-6-12(7-5-10)15-9-11-3-1-2-8-14-11/h4-7,11,14H,1-3,8-9H2

InChI key: InChIKey=DUNOIBBUFFDGDC-UHFFFAOYSA-N

SMILES: S(CC1CCCCN1)C2=CC=C(F)C=C2

Synonyms:

• 2-[[(4-Fluorophenyl)thio]methyl]piperidine
• Piperidine, 2-[[(4-fluorophenyl)thio]methyl]-