CymitQuimica logo

CAS 124773-10-0

:

N-[4-Chloro-3-[[4,5-dihydro-5-oxo-1-(2,4,6-trichlorophenyl)-1H-pyrazol-3-yl]amino]phenyl]-2-[4-(1,1,3,3-tetramethylbutyl)phenoxy]butanamide

Description:
N-[4-Chloro-3-[[4,5-dihydro-5-oxo-1-(2,4,6-trichlorophenyl)-1H-pyrazol-3-yl]amino]phenyl]-2-[4-(1,1,3,3-tetramethylbutyl)phenoxy]butanamide, with CAS number 124773-10-0, is a synthetic organic compound characterized by its complex molecular structure, which includes multiple functional groups such as amides, phenoxy, and pyrazole moieties. This compound exhibits significant biological activity, often studied for its potential applications in pharmaceuticals, particularly in the field of anti-inflammatory or anti-cancer agents. Its structure features a chloro-substituted phenyl group and a bulky tetramethylbutyl group, which may influence its solubility and bioavailability. The presence of the pyrazole ring contributes to its pharmacological properties, while the amide linkage plays a crucial role in its stability and interaction with biological targets. Overall, this compound represents a class of molecules that are of interest in medicinal chemistry due to their potential therapeutic effects and the intricate interplay of their structural components.
Formula:C33H36Cl4N4O3
InChI:InChI=1S/C33H36Cl4N4O3/c1-7-27(44-22-11-8-19(9-12-22)33(5,6)18-32(2,3)4)31(43)38-21-10-13-23(35)26(16-21)39-28-17-29(42)41(40-28)30-24(36)14-20(34)15-25(30)37/h8-16,27H,7,17-18H2,1-6H3,(H,38,43)(H,39,40)
InChI key:InChIKey=CDIWFSQELROWJU-UHFFFAOYSA-N
SMILES:ClC1=C(C(Cl)=CC(Cl)=C1)N2N=C(NC3=CC(NC(C(OC4=CC=C(C(CC(C)(C)C)(C)C)C=C4)CC)=O)=CC=C3Cl)CC2=O
Synonyms:
  • Butanamide, N-[4-chloro-3-[[4,5-dihydro-5-oxo-1-(2,4,6-trichlorophenyl)-1H-pyrazol-3-yl]amino]phenyl]-2-[4-(1,1,3,3-tetramethylbutyl)phenoxy]-
  • N-[4-Chloro-3-[[4,5-dihydro-5-oxo-1-(2,4,6-trichlorophenyl)-1H-pyrazol-3-yl]amino]phenyl]-2-[4-(1,1,3,3-tetramethylbutyl)phenoxy]butanamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.