CymitQuimica logo

CAS 124775-33-3

:

Carbamic acid, dimethyl-, 1-oxido-3-pyridinyl ester

Description:
Carbamic acid, dimethyl-, 1-oxido-3-pyridinyl ester, with the CAS number 124775-33-3, is an organic compound characterized by its ester functional group derived from carbamic acid and dimethylamine. This compound features a pyridine ring, which contributes to its aromatic properties and potential biological activity. The presence of the oxido group indicates that it may have reactive oxygen functionalities, which can influence its chemical behavior and interactions. Typically, such compounds are of interest in various fields, including medicinal chemistry and agrochemicals, due to their potential as bioactive agents. The molecular structure suggests that it may exhibit specific solubility characteristics, stability under certain conditions, and reactivity with nucleophiles or electrophiles. Additionally, the compound's properties may be influenced by factors such as pH, temperature, and the presence of other chemical species. Overall, carbamic acid derivatives are often studied for their roles in pharmacology and as intermediates in organic synthesis.
Formula:C8H10N2O3
InChI:InChI=1S/C8H10N2O3/c1-9(2)8(11)13-7-4-3-5-10(12)6-7/h3-6H,1-2H3
InChI key:InChIKey=AWTBSCZHBNQKEB-UHFFFAOYSA-N
SMILES:O(C(N(C)C)=O)C1=CN(=O)=CC=C1
Synonyms:
  • Carbamic acid, dimethyl-, 3-pyridinyl ester, N-oxide
  • Carbamic acid, dimethyl-, 1-oxido-3-pyridinyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.