
CAS 124777-80-6
:α-Amino-2,5-difluorobenzeneacetonitrile
Description:
α-Amino-2,5-difluorobenzeneacetonitrile, with the CAS number 124777-80-6, is an organic compound characterized by the presence of both amino and nitrile functional groups, along with two fluorine substituents on a benzene ring. This compound typically exhibits a solid state at room temperature and is soluble in polar organic solvents due to the presence of the nitrile group, which can engage in hydrogen bonding. The difluorobenzene moiety contributes to its unique electronic properties, potentially influencing its reactivity and interactions in chemical processes. The amino group can participate in various reactions, such as nucleophilic substitutions or coupling reactions, making it a valuable intermediate in organic synthesis. Additionally, the presence of fluorine atoms often enhances the compound's stability and lipophilicity, which can be advantageous in pharmaceutical applications. Overall, α-Amino-2,5-difluorobenzeneacetonitrile is a versatile compound with potential utility in medicinal chemistry and materials science.
Formula:C8H6F2N2
InChI:InChI=1S/C8H6F2N2/c9-5-1-2-7(10)6(3-5)8(12)4-11/h1-3,8H,12H2
InChI key:InChIKey=KHFQZWKSHNKHJN-UHFFFAOYSA-N
SMILES:C(C#N)(N)C1=C(F)C=CC(F)=C1
Synonyms:- 2-Amino-2-(2,5-difluorophenyl)acetonitrile
- Benzeneacetonitrile, α-amino-2,5-difluoro-
- α-Amino-2,5-difluorobenzeneacetonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.