
CAS 1247790-47-1
:3,6-Dimethyl-2-heptanol
Description:
3,6-Dimethyl-2-heptanol is an organic compound classified as a secondary alcohol due to the presence of a hydroxyl (-OH) group attached to a carbon atom that is bonded to two other carbon atoms. Its molecular structure features a heptane backbone with two methyl groups located at the 3rd and 6th positions, contributing to its branched nature. This compound is typically a colorless liquid at room temperature and exhibits a characteristic alcohol odor. It is soluble in organic solvents and has limited solubility in water, which is common for larger alcohols. The presence of the hydroxyl group imparts some polar characteristics, influencing its reactivity and interactions with other substances. 3,6-Dimethyl-2-heptanol can participate in various chemical reactions, including oxidation and esterification, making it of interest in organic synthesis and industrial applications. Its specific properties, such as boiling point and density, can vary based on environmental conditions and purity. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C9H20O
InChI:InChI=1S/C9H20O/c1-7(2)5-6-8(3)9(4)10/h7-10H,5-6H2,1-4H3
InChI key:InChIKey=NTDKHABICKZMPG-UHFFFAOYSA-N
SMILES:C(CCC(C)C)(C(C)O)C
Synonyms:- 3,6-Dimethyl-2-heptanol
- Terpirosa
- 2-Heptanol, 3,6-dimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.