CymitQuimica logo

CAS 1247810-30-5

:

3-(1-Methylethyl)-1H-pyrazole-4-sulfonyl chloride

Description:
3-(1-Methylethyl)-1H-pyrazole-4-sulfonyl chloride is a chemical compound characterized by its sulfonyl chloride functional group, which is known for its reactivity and ability to form sulfonamides. This compound features a pyrazole ring, a five-membered aromatic heterocycle containing two nitrogen atoms, which contributes to its unique chemical properties. The presence of the isopropyl group (1-methylethyl) enhances its hydrophobic characteristics, potentially influencing its solubility and reactivity in various solvents. As a sulfonyl chloride, it is likely to be a potent electrophile, making it useful in organic synthesis, particularly for the introduction of sulfonyl groups into other molecules. This compound may also exhibit biological activity, although specific biological properties would depend on its application and the context of use. Safety precautions should be taken when handling this substance, as sulfonyl chlorides can be corrosive and may release toxic gases upon reaction with water or alcohols.
Formula:C6H9ClN2O2S
InChI:InChI=1S/C6H9ClN2O2S/c1-4(2)6-5(3-8-9-6)12(7,10)11/h3-4H,1-2H3,(H,8,9)
InChI key:InChIKey=IWXGZORVHBWJGH-UHFFFAOYSA-N
SMILES:S(Cl)(=O)(=O)C=1C(C(C)C)=NNC1
Synonyms:
  • 1H-Pyrazole-4-sulfonyl chloride, 3-(1-methylethyl)-
  • 3-(1-Methylethyl)-1H-pyrazole-4-sulfonyl chloride
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.