
CAS 1247879-15-7
:6,7-Dihydro-5-methyl-5H-pyrrolo[3,2-f]benzothiazole-2-carbonitrile
Description:
6,7-Dihydro-5-methyl-5H-pyrrolo[3,2-f]benzothiazole-2-carbonitrile is a heterocyclic compound characterized by its unique bicyclic structure, which combines elements of pyrrole and benzothiazole. This compound features a pyrrolo ring fused to a benzothiazole moiety, contributing to its potential biological activity. The presence of a carbonitrile group enhances its reactivity and may influence its pharmacological properties. Typically, compounds of this nature exhibit a range of biological activities, including antimicrobial and anticancer properties, making them of interest in medicinal chemistry. The methyl group at the 5-position of the pyrrolo ring can affect the compound's lipophilicity and overall stability. Additionally, the compound's molecular structure suggests potential for interactions with various biological targets, which can be explored in drug development. Its specific properties, such as solubility, melting point, and spectral characteristics, would require empirical measurement or detailed computational analysis for precise characterization. Overall, this compound represents a fascinating area of study within the field of organic and medicinal chemistry.
Formula:C11H9N3S
InChI:InChI=1S/C11H9N3S/c1-14-3-2-7-4-8-10(5-9(7)14)15-11(6-12)13-8/h4-5H,2-3H2,1H3
InChI key:InChIKey=RESLCXJZBAZOEA-UHFFFAOYSA-N
SMILES:C(#N)C1=NC2=C(C=C3C(=C2)CCN3C)S1
Synonyms:- 6,7-Dihydro-5-methyl-5H-pyrrolo[3,2-f]benzothiazole-2-carbonitrile
- 5H-Pyrrolo[3,2-f]benzothiazole-2-carbonitrile, 6,7-dihydro-5-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.