CAS 124788-09-6
:1,4-Diphosphorinan-2,3,5,6-tetrol, 1,4-bis(2-methylpropyl) 1,4-di-
Description:
1,4-Diphosphorinan-2,3,5,6-tetrol, 1,4-bis(2-methylpropyl) 1,4-di- is a complex chemical compound characterized by its unique structure, which includes a diphosphorinan framework and multiple hydroxyl (alcohol) functional groups. The presence of two phosphorus atoms in its structure suggests potential applications in areas such as catalysis or as a ligand in coordination chemistry. The bis(2-methylpropyl) substituents indicate that the compound has branched alkyl groups, which can influence its solubility and reactivity. The hydroxyl groups contribute to its polarity and may enhance its ability to form hydrogen bonds, affecting its physical properties like boiling point and melting point. Additionally, the compound's specific stereochemistry and functional groups may impart unique biological or chemical reactivity, making it of interest in various fields, including materials science and pharmaceuticals. However, detailed studies would be necessary to fully understand its properties and potential applications.
Formula:C12H26O6P2
InChI:InChI=1S/C12H26O6P2/c1-7(2)5-19(17)9(13)11(15)20(18,6-8(3)4)12(16)10(19)14/h7-16H,5-6H2,1-4H3
InChI key:InChIKey=YLYUAJJICVNRHL-UHFFFAOYSA-N
SMILES:C(C(C)C)P1(=O)C(O)C(O)P(CC(C)C)(=O)C(O)C1O
Synonyms:- 1,4-Diphosphorinane-2,3,5,6-tetrol, 1,4-bis(2-methylpropyl)-, 1,4-dioxide
- Cyagard RF 1204
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
