
CAS 1247914-82-4
:2-[(1,2-Dimethylbutyl)amino]-4-methyl-1-pentanol
Description:
2-[(1,2-Dimethylbutyl)amino]-4-methyl-1-pentanol is an organic compound characterized by its amine and alcohol functional groups. It features a branched alkyl chain, which contributes to its hydrophobic properties, while the amino group provides basicity and potential for hydrogen bonding. This compound is likely to exhibit moderate solubility in polar solvents due to the presence of the hydroxyl (-OH) group, while its larger hydrophobic tail may limit solubility in water. The structure suggests that it may have applications in pharmaceuticals or as a surfactant, given the combination of its polar and non-polar characteristics. Additionally, the presence of multiple methyl groups can influence its steric hindrance and reactivity, potentially affecting its biological activity. Safety and handling precautions should be observed, as with many amines and alcohols, due to potential irritant properties. Overall, this compound represents a unique blend of functional groups that may be of interest in various chemical and industrial applications.
Formula:C12H27NO
InChI:InChI=1S/C12H27NO/c1-6-10(4)11(5)13-12(8-14)7-9(2)3/h9-14H,6-8H2,1-5H3
InChI key:InChIKey=UEVLHGHLZPUAIY-UHFFFAOYSA-N
SMILES:C(NC(C(CC)C)C)(CC(C)C)CO
Synonyms:- 2-[(1,2-Dimethylbutyl)amino]-4-methyl-1-pentanol
- 1-Pentanol, 2-[(1,2-dimethylbutyl)amino]-4-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.