CAS 124797-64-4

2-Methoxy-4-[2-(4-nitrophenyl)ethenyl]phenol

Description:

2-Methoxy-4-[2-(4-nitrophenyl)ethenyl]phenol, with the CAS number 124797-64-4, is an organic compound characterized by its complex structure, which includes a methoxy group, a phenolic hydroxyl group, and a nitrophenyl substituent. This compound typically exhibits properties associated with phenolic compounds, such as potential antioxidant activity and the ability to participate in various chemical reactions due to the presence of the hydroxyl group. The nitro group introduces electron-withdrawing characteristics, which can influence the compound's reactivity and stability. Additionally, the presence of the ethenyl group suggests that it may engage in further polymerization or addition reactions. The compound's solubility is likely influenced by the methoxy and hydroxyl groups, making it more soluble in polar solvents. Its applications may span across fields such as organic synthesis, materials science, and potentially in pharmaceuticals, depending on its biological activity. Overall, the unique combination of functional groups in 2-Methoxy-4-[2-(4-nitrophenyl)ethenyl]phenol contributes to its diverse chemical behavior and potential utility in various applications.

Formula: C₁₅H₁₃NO₄

InChI: InChI=1S/C15H13NO4/c1-20-15-10-12(6-9-14(15)17)3-2-11-4-7-13(8-5-11)16(18)19/h2-10,17H,1H3

InChI key: InChIKey=MXVJQFUHKLOOCR-UHFFFAOYSA-N

SMILES: C(=CC1=CC=C(N(=O)=O)C=C1)C2=CC(OC)=C(O)C=C2

Synonyms:

• Phenol, 2-methoxy-4-[2-(4-nitrophenyl)ethenyl]-
• 2-Methoxy-4-[2-(4-nitrophenyl)ethenyl]phenol

Phenol, 2-methoxy-4-[2-(4-nitrophenyl)ethenyl]-

CAS: 124797-64-4

Formula: C₁₅H₁₃NO₄

Molecular weight: 271.268

Ref: IN-DA000MR0