CymitQuimica logo

CAS 124800-34-6

:

Ethyl 4-chloro-3-ethyl-1-methyl-1H-pyrazole-5-carboxylate

Description:
Ethyl 4-chloro-3-ethyl-1-methyl-1H-pyrazole-5-carboxylate is a chemical compound characterized by its pyrazole ring structure, which is a five-membered ring containing two nitrogen atoms. This compound features a carboxylate functional group, contributing to its reactivity and potential applications in organic synthesis. The presence of chlorine and ethyl groups on the pyrazole ring enhances its chemical properties, making it a subject of interest in various fields, including medicinal chemistry and agrochemicals. The ethyl ester group indicates that it can undergo hydrolysis to form the corresponding acid, which may exhibit different biological activities. Its molecular structure suggests potential interactions with biological targets, making it a candidate for further research in drug development. Additionally, the compound's stability and solubility characteristics can influence its behavior in different solvents and environments, which is crucial for its application in formulations. Overall, Ethyl 4-chloro-3-ethyl-1-methyl-1H-pyrazole-5-carboxylate represents a versatile compound with significant potential in chemical research and application.
Formula:C9H13ClN2O2
InChI:InChI=1S/C9H13ClN2O2/c1-4-6-7(10)8(12(3)11-6)9(13)14-5-2/h4-5H2,1-3H3
InChI key:InChIKey=CUKJHWLTDJWPHN-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C1=C(Cl)C(CC)=NN1C
Synonyms:
  • 1H-Pyrazole-5-carboxylic acid, 4-chloro-3-ethyl-1-methyl-, ethyl ester
  • 4-Chloro-5-ethyl-2-methyl-2H-pyrazole-3-carboxylic acid ethyl ester
  • Ethyl 1-methyl-3-ethyl-4-chloro-5-pyrazolecarboxylate
  • Ethyl 4-chloro-3-ethyl-1-methyl-1H-pyrazole-5-carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.