CAS 1248012-77-2

3-Chloro-N-[2-(3-pyridinyl)ethyl]-2-pyrazinamine

Description:

3-Chloro-N-[2-(3-pyridinyl)ethyl]-2-pyrazinamine is a chemical compound characterized by its unique structure, which includes a pyrazinamine core substituted with a chloro group and a pyridinyl ethyl side chain. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, contributing to its potential biological activity. The presence of the chloro substituent can influence its reactivity and solubility, while the pyridinyl group may enhance its interaction with biological targets, making it of interest in medicinal chemistry. The compound's molecular structure suggests it may participate in hydrogen bonding and other intermolecular interactions, which are crucial for its function in biological systems. Additionally, its specific arrangement of atoms may confer unique pharmacological properties, potentially making it a candidate for further research in drug development. As with many organic compounds, its stability, solubility, and reactivity can vary based on environmental conditions and the presence of other chemical species.

Formula: C₁₁H₁₁ClN₄

InChI: InChI=1S/C11H11ClN4/c12-10-11(16-7-6-14-10)15-5-3-9-2-1-4-13-8-9/h1-2,4,6-8H,3,5H2,(H,15,16)

InChI key: InChIKey=IFXIQICUMIGFSI-UHFFFAOYSA-N

SMILES: N(CCC=1C=CC=NC1)C=2C(Cl)=NC=CN2

Synonyms:

• 3-Chloro-N-[2-(3-pyridinyl)ethyl]-2-pyrazinamine
• 2-Pyrazinamine, 3-chloro-N-[2-(3-pyridinyl)ethyl]-