CAS 124805-94-3
:(2E)-3-(3,5-dimethoxyphenyl)prop-2-enamide
Description:
(2E)-3-(3,5-dimethoxyphenyl)prop-2-enamide, with the CAS number 124805-94-3, is an organic compound characterized by its conjugated double bond system and an amide functional group. This compound features a prop-2-enamide backbone, which indicates the presence of a vinyl group adjacent to an amide, contributing to its potential reactivity and stability. The presence of the 3,5-dimethoxyphenyl substituent enhances its lipophilicity and may influence its biological activity, making it of interest in medicinal chemistry. The methoxy groups can also participate in hydrogen bonding and may affect the compound's solubility and interaction with biological targets. Additionally, the geometric configuration (2E) indicates that the double bond has a specific trans arrangement, which can impact the compound's spatial orientation and, consequently, its reactivity and interactions. Overall, this compound's unique structural features suggest potential applications in pharmaceuticals or as a building block in organic synthesis.
Formula:C11H13NO3
InChI:InChI=1/C11H13NO3/c1-14-9-5-8(3-4-11(12)13)6-10(7-9)15-2/h3-7H,1-2H3,(H2,12,13)/b4-3+
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
3,5-Dimethoxycinnamide
CAS:3,5-Dimethoxycinnamide is a compound that has been shown to inhibit the C1-4 alkoxy and C1-4 alkyl esterase activity of the enzyme secretase. This enzyme is involved in the production of amyloid beta peptides and is thought to be an important contributor to Alzheimer's Disease. 3,5-Dimethoxycinnamide also inhibits the aspartyl protease activity of aspartyl proteases, which are enzymes that may play a role in Alzheimer's disease. 3,5-Dimethoxycinnamide binds to the hydrophobic region of these enzymes and prevents them from binding to their substrates. The affinity of this compound for these enzymes precludes its ability to bind with other proteins in the brain, thereby reducing its potential toxicity. 3,5-Dimethoxycinnamide can be labeled with halogeno groups or other chemical moieties for profiling purposes.Formula:C11H13NO3Purity:Min. 95%Molecular weight:207.23 g/mol
