CAS 1248090-43-8

2,3-Dihydro-2,5,7-trimethyl-3-benzofuranamine

Description:

2,3-Dihydro-2,5,7-trimethyl-3-benzofuranamine is a chemical compound characterized by its unique structure, which includes a benzofuran moiety and an amine functional group. This compound features a bicyclic structure that contributes to its potential biological activity. The presence of multiple methyl groups (trimethyl) enhances its hydrophobic characteristics, which can influence its solubility and interaction with biological membranes. The amine group may impart basic properties, allowing for potential interactions with acidic environments or other polar molecules. This compound may be of interest in medicinal chemistry due to its structural features, which could be relevant for drug design or as a lead compound in pharmacological studies. However, specific data regarding its reactivity, stability, and biological effects would require further investigation through experimental studies. As with many organic compounds, the synthesis, purification, and characterization methods would be crucial for understanding its properties and potential applications in various fields, including pharmaceuticals and materials science.

Formula: C₁₁H₁₅NO

InChI: InChI=1S/C11H15NO/c1-6-4-7(2)11-9(5-6)10(12)8(3)13-11/h4-5,8,10H,12H2,1-3H3

InChI key: InChIKey=JGQQOUKHYKNERP-UHFFFAOYSA-N

SMILES: CC1=C2C(C(N)C(C)O2)=CC(C)=C1

Synonyms:

• 2,5,7-Trimethyl-2,3-dihydro-1-benzofuran-3-amine
• 2,3-Dihydro-2,5,7-trimethyl-3-benzofuranamine
• 3-Benzofuranamine, 2,3-dihydro-2,5,7-trimethyl-