CymitQuimica logo

CAS 1248246-51-6

:

Benzo[b]thiophen-3-amine, 5-bromo-2,3-dihydro-2-methyl-, 1,1-dioxide

Description:
Benzo[b]thiophen-3-amine, 5-bromo-2,3-dihydro-2-methyl-, 1,1-dioxide, identified by its CAS number 1248246-51-6, is a chemical compound that features a fused ring system comprising a benzothiophene moiety. This compound is characterized by the presence of a bromine atom at the 5-position and a methyl group at the 2-position of the dihydro structure, contributing to its unique reactivity and potential biological activity. The 1,1-dioxide functional group indicates the presence of sulfone functionality, which can enhance solubility and influence the compound's interaction with biological targets. Typically, compounds of this nature may exhibit interesting pharmacological properties, making them of interest in medicinal chemistry. The presence of both aromatic and aliphatic components in its structure suggests potential applications in organic synthesis and drug development. As with many heterocyclic compounds, its properties, such as solubility, stability, and reactivity, can be significantly influenced by the specific substituents and their positions on the ring system.
Formula:C9H10BrNO2S
InChI:InChI=1S/C9H10BrNO2S/c1-5-9(11)7-4-6(10)2-3-8(7)14(5,12)13/h2-5,9H,11H2,1H3
InChI key:InChIKey=HSLYDEAOOXOAAK-UHFFFAOYSA-N
SMILES:NC1C=2C(S(=O)(=O)C1C)=CC=C(Br)C2
Synonyms:
  • Benzo[b]thiophen-3-amine, 5-bromo-2,3-dihydro-2-methyl-, 1,1-dioxide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.