CymitQuimica logo

CAS 124832-29-7

:

L-Isoleucine, 2-[(2-amino-1,6-dihydro-6-oxo-9H-purin-9-yl)methoxy]ethyl ester, hydrochloride

Description:
L-Isoleucine, 2-[(2-amino-1,6-dihydro-6-oxo-9H-purin-9-yl)methoxy]ethyl ester, hydrochloride, identified by CAS number 124832-29-7, is a chemical compound that combines the amino acid isoleucine with a purine derivative. This compound features a methoxyethyl ester functional group, which contributes to its solubility and reactivity. As a hydrochloride salt, it is typically more stable and soluble in aqueous solutions, making it suitable for various biochemical applications. The presence of the purine moiety suggests potential interactions with biological systems, particularly in nucleic acid metabolism or signaling pathways. L-Isoleucine itself is one of the essential branched-chain amino acids, playing a crucial role in protein synthesis and energy production. The specific structure of this compound may influence its pharmacological properties, including its potential as a therapeutic agent or a biochemical probe. Overall, this compound exemplifies the intersection of amino acid chemistry and purine biochemistry, highlighting its relevance in both research and potential therapeutic contexts.
Formula:C14H22N6O4·xClH
InChI:InChI=1S/C14H22N6O4.ClH/c1-3-8(2)9(15)13(22)24-5-4-23-7-20-6-17-10-11(20)18-14(16)19-12(10)21;/h6,8-9H,3-5,7,15H2,1-2H3,(H3,16,18,19,21);1H/t8-,9-;/m0./s1
InChI key:InChIKey=WTBHYMWEURPQQT-OZZZDHQUSA-N
SMILES:C(OCCOC([C@H]([C@H](CC)C)N)=O)N1C2=C(C(=O)N=C(N)N2)N=C1.Cl
Synonyms:
  • L-Isoleucine, 2-[(2-amino-1,6-dihydro-6-oxo-9H-purin-9-yl)methoxy]ethyl ester, hydrochloride
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.