CAS 124833-45-0
:AP 811
Description:
AP 811, with the CAS number 124833-45-0, is a chemical compound that belongs to the class of substances known as phosphonates. It is primarily recognized for its application in agricultural and industrial settings, particularly as a plant growth regulator. The compound exhibits properties that can enhance nutrient uptake and improve overall plant health. AP 811 is characterized by its ability to influence physiological processes in plants, potentially leading to increased yield and improved resistance to environmental stressors. In terms of safety and handling, like many chemical substances, it is essential to follow appropriate guidelines to mitigate any risks associated with exposure. The specific physical and chemical properties, such as solubility, stability, and reactivity, can vary based on formulation and environmental conditions. As with any chemical, thorough understanding and adherence to regulatory standards are crucial for its effective and safe use in relevant applications.
Formula:C46H66N12O8
InChI:InChI=1/C46H66N12O8/c1-5-27(3)26-53-34(13-9-21-51-45(47)48)41(63)58-43(65)36(25-38(60)61)56-44(66)39(28(4)6-2)57-42(64)35(14-10-22-52-46(49)50)55-37(59)23-29-15-19-33(20-16-29)54-40(62)32-18-17-30-11-7-8-12-31(30)24-32/h7-8,11-12,15-20,24,27-28,34-36,39,53H,5-6,9-10,13-14,21-23,25-26H2,1-4H3,(H,54,62)(H,55,59)(H,56,66)(H,57,64)(H,60,61)(H4,47,48,51)(H4,49,50,52)(H,58,63,65)/t27-,28-,34-,35-,36-,39-/m0/s1
SMILES:CC[C@H](C)CN[C@@H](CCCNC(=N)N)C(=NC(=O)[C@H](CC(=O)O)N=C([C@H]([C@@H](C)CC)N=C([C@H](CCCNC(=N)N)N=C(Cc1ccc(cc1)NC(=O)c1ccc2ccccc2c1)O)O)O)O
Synonyms:- (S)-N2-((4-((2-Naphthalenylcarbonyl)amino)phenyl)acetyl)-L-arginyl-L-isoleucyl-L-alpha-aspartyl-N-(2-methylbutyl)-L-argininamide
- L-Argininamide, N2-((4-((2-naphthalenylcarbonyl)amino)phenyl)acetyl)-L-arginyl-L-isoleucyl-L-alpha-aspartyl-N-(2-methylbutyl)-, (S)-
- N~5~-(diaminomethylidene)-N~2~-({4-[(naphthalen-2-ylcarbonyl)amino]phenyl}acetyl)-L-ornithyl-L-isoleucyl-N-[(2S)-5-[(diaminomethylidene)amino]-2-{[(2S)-2-methylbutyl]amino}pentanoyl]-L-alpha-asparagine
- AP-811
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
AP 811
CAS:AP 811: Selective NPR3 antagonist, Ki of 0.48 nM, >20,000x selective over NPR1, blocks ANP-induced pump stimulation.Formula:C46H66N12O8Color and Shape:SolidMolecular weight:915.11N2-[2-[4-[(2-Naphthalenylcarbonyl)amino]phenyl]acetyl]-L-arginyl-L-isoleucyl-L-α-aspartyl-N-[(2S)-2-methylbutyl]-L-argininamide
CAS:N2-[2-[4-[(2-Naphthalenylcarbonyl)amino]phenyl]acetyl]-L-arginyl-L-isoleucyl-L-α-aspartyl-N-[(2S)-2-methylbutyl]-L-argininamide is a synthetic peptide drug, which is a product of advanced chemical synthesis processes. It functions as a selective inhibitor, targeting specific proteolytic enzymes involved in pathological conditions. The molecular structure allows it to engage in precise interactions with target enzymes, thereby modulating biological pathways and offering therapeutic potential.Formula:C46H66N12O8Purity:Min. 95%Molecular weight:915.09 g/mol

