CAS 124841-30-1

1H-Benzimidazol-5-ol,4-chloro-(9CI)

Description:

1H-Benzimidazol-5-ol, 4-chloro- (9CI), with the CAS number 124841-30-1, is a chemical compound characterized by its benzimidazole core structure, which consists of a fused benzene and imidazole ring. The presence of a hydroxyl group (-OH) at the 5-position and a chlorine atom at the 4-position contributes to its unique chemical properties. This compound is typically a white to off-white solid and is soluble in polar solvents, reflecting its potential for hydrogen bonding due to the hydroxyl group. It may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of compounds with antimicrobial or antifungal properties. The chlorine substituent can influence the compound's reactivity and interaction with biological targets. As with many benzimidazole derivatives, it may also participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, which are valuable in synthetic organic chemistry. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.

Formula: C₇H₅ClN₂O

InChI: InChI=1/C7H5ClN2O/c8-6-5(11)2-1-4-7(6)10-3-9-4/h1-3,11H,(H,9,10)

SMILES: c1cc(c(c2c1nc[nH]2)Cl)O

Synonyms:

• 1H-Benzimidazol-5-Ol, 4-Chloro
• 4-chloro-1H-benzimidazol-5-ol

1H-Benzimidazol-5-ol,4-chloro-(9CI)

CAS: 124841-30-1

Formula: C₇H₅ClN₂O

Purity: 98%

Color and Shape: Solid

Molecular weight: 168.5804

Ref: IN-DA009D05

4-Chloro-1H-benzo[d]imidazol-5-ol

CAS: 124841-30-1

4-Chloro-1H-benzo[d]imidazol-5-ol

Purity: 98%

Molecular weight: 168.58g/mol

Ref: 54-OR1035759

4-Chloro-1H-benzimidazol-5-ol

CAS: 124841-30-1

Formula: C₇H₅ClN₂O

Purity: 98%

Molecular weight: 168.58

Ref: 10-F493893