CAS 124845-04-1

5-Cyclopropyl-4-isoxazolecarboxylic acid

Description:

5-Cyclopropyl-4-isoxazolecarboxylic acid is a chemical compound characterized by its unique isoxazole ring structure, which is a five-membered heterocyclic compound containing both nitrogen and oxygen. The presence of a cyclopropyl group contributes to its distinct properties, influencing its reactivity and potential biological activity. This compound is typically a white to off-white solid and is soluble in polar solvents, which is common for carboxylic acids due to their ability to form hydrogen bonds. The carboxylic acid functional group (-COOH) imparts acidic characteristics, allowing it to participate in various chemical reactions, including esterification and amidation. 5-Cyclopropyl-4-isoxazolecarboxylic acid has garnered interest in medicinal chemistry, particularly for its potential applications in drug development, as compounds with isoxazole moieties often exhibit significant pharmacological activities. Its specific interactions and mechanisms of action would depend on the context of its use and the biological targets involved.

Formula: C₇H₇NO₃

InChI: InChI=1S/C7H7NO3/c9-7(10)5-3-8-11-6(5)4-1-2-4/h3-4H,1-2H2,(H,9,10)

InChI key: InChIKey=KIJMAOMSRMPYIY-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C(ON=C1)C2CC2

Synonyms:

• 4-Isoxazolecarboxylic acid, 5-cyclopropyl-
• 4-Isoxazolecarboxylicacid,5-cyclopropyl-(9CI)
• 5-Cyclopropyl-4-isoxazolecarboxylic acid
• 5-Cyclopropylisoxazole-4-Carboxylic Acid

4-Isoxazolecarboxylic acid, 5-cyclopropyl-

CAS: 124845-04-1

Formula: C₇H₇NO₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 153.1354

Ref: IN-DA000MT7

5-Cyclopropylisoxazole-4-carboxylic acid

CAS: 124845-04-1

5-Cyclopropylisoxazole-4-carboxylic acid

Purity: 97%

Molecular weight: 153.14g/mol

Ref: 54-OR922620

5-Cyclopropylisoxazole-4-carboxylic acid

CAS: 124845-04-1

Purity: 98%

Molecular weight: 153.1369934

Ref: 10-F635422

5-Cyclopropylisoxazole-4-carboxylic acid

CAS: 124845-04-1

5-Cyclopropylisoxazole-4-carboxylic acid is a versatile compound that has various applications in different fields. It can be used as a photocatalytic agent, particularly in the production of copolymers and polymers. Additionally, it is commonly utilized in research laboratories as a potassium source for experiments. This compound also exhibits inhibitory properties, making it useful as an inhibitor in various processes. Furthermore, 5-Cyclopropylisoxazole-4-carboxylic acid has been studied for its potential use as an anesthetic and has shown promising results. Its unique characteristics make it a valuable component in the development of new materials and chemical compounds.

Formula: C₇H₇NO₃

Purity: Min. 95%

Molecular weight: 153.14 g/mol

Ref: 3D-ZEA84504