CAS 1248551-35-0: 5-Phenyl-2-pyrrolidinemethanol

Description:5-Phenyl-2-pyrrolidinemethanol is a chemical compound characterized by its pyrrolidine ring structure, which is a five-membered nitrogen-containing heterocycle. The presence of a phenyl group attached to the second carbon of the pyrrolidine ring contributes to its aromatic properties and can influence its reactivity and interactions with other molecules. This compound features a hydroxymethyl group (-CH2OH) at the 2-position, which can participate in hydrogen bonding, enhancing its solubility in polar solvents. The molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of both the nitrogen atom and the hydroxyl group, which can serve as sites for further chemical modifications. Additionally, the compound may exhibit interesting biological activities, although specific studies would be necessary to elucidate its pharmacological profile. Overall, 5-Phenyl-2-pyrrolidinemethanol represents a versatile scaffold for further exploration in chemical synthesis and drug development.

Formula:C₁₁H₁₅NO

InChI:InChI=1S/C11H15NO/c13-8-10-6-7-11(12-10)9-4-2-1-3-5-9/h1-5,10-13H,6-8H2

InChI key:InChIKey=QJOZAASSNRABQY-UHFFFAOYSA-N

SMILES:OCC1NC(C=2C=CC=CC2)CC1

Synonyms:
2-Pyrrolidinemethanol, 5-phenyl-
5-Phenyl-2-pyrrolidinemethanol

Found 2 products.

Brand	Product data	Purity	Price range	Estimated delivery
	(5-Phenylpyrrolidin-2-yl)methanol REF: 10-F673576CAS: 1248551-35-0	98%	- - -	Discontinued product
	(5-Phenylpyrrolidin-2-yl)methanol REF: 3D-YZB55135CAS: 1248551-35-0	Min. 95%	- - -	Discontinued product