
CAS 1248551-35-0
:5-Phenyl-2-pyrrolidinemethanol
Description:
5-Phenyl-2-pyrrolidinemethanol is a chemical compound characterized by its pyrrolidine ring structure, which is a five-membered nitrogen-containing heterocycle. The presence of a phenyl group attached to the second carbon of the pyrrolidine ring contributes to its aromatic properties and can influence its reactivity and interactions with other molecules. This compound features a hydroxymethyl group (-CH2OH) at the 2-position, which can participate in hydrogen bonding, enhancing its solubility in polar solvents. The molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of both the nitrogen atom and the hydroxyl group, which can serve as sites for further chemical modifications. Additionally, the compound may exhibit interesting biological activities, although specific studies would be necessary to elucidate its pharmacological profile. Overall, 5-Phenyl-2-pyrrolidinemethanol represents a versatile scaffold for further exploration in chemical synthesis and drug development.
Formula:C11H15NO
InChI:InChI=1S/C11H15NO/c13-8-10-6-7-11(12-10)9-4-2-1-3-5-9/h1-5,10-13H,6-8H2
InChI key:InChIKey=QJOZAASSNRABQY-UHFFFAOYSA-N
SMILES:C(O)C1NC(CC1)C2=CC=CC=C2
Synonyms:- 2-Pyrrolidinemethanol, 5-phenyl-
- 5-Phenyl-2-pyrrolidinemethanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.