CymitQuimica logo

CAS 124863-82-7

:

[5-({[tert-butyl(dimethyl)silyl]oxy}methyl)-4-(4-fluorophenyl)-2,6-bis(1-methylethyl)pyridin-3-yl]methanol

Description:
The chemical substance with the name "[5-({[tert-butyl(dimethyl)silyl]oxy}methyl)-4-(4-fluorophenyl)-2,6-bis(1-methylethyl)pyridin-3-yl]methanol" and CAS number "124863-82-7" is a complex organic compound characterized by its pyridine core, which is substituted at various positions. The presence of a tert-butyl(dimethyl)silyl group indicates that the compound has significant steric bulk, which can influence its reactivity and solubility. The fluorophenyl group suggests potential electronic effects that may enhance the compound's biological activity or interaction with other molecules. Additionally, the methanol functional group implies the presence of hydroxyl functionality, which can participate in hydrogen bonding and affect the compound's solubility in polar solvents. Overall, this compound's unique structural features may contribute to its potential applications in medicinal chemistry or materials science, although specific properties such as melting point, boiling point, and solubility would require empirical determination or literature reference for precise characterization.
Formula:C25H38FNO2Si
InChI:InChI=1/C25H38FNO2Si/c1-16(2)23-20(14-28)22(18-10-12-19(26)13-11-18)21(24(27-23)17(3)4)15-29-30(8,9)25(5,6)7/h10-13,16-17,28H,14-15H2,1-9H3
SMILES:CC(C)c1c(CO)c(c2ccc(cc2)F)c(CO[Si](C)(C)C(C)(C)C)c(C(C)C)n1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.