CAS 124863-83-8
:5-({[tert-butyl(dimethyl)silyl]oxy}methyl)-4-(4-fluorophenyl)-2,6-bis(1-methylethyl)pyridine-3-carbaldehyde
Description:
The chemical substance known as 5-({[tert-butyl(dimethyl)silyl]oxy}methyl)-4-(4-fluorophenyl)-2,6-bis(1-methylethyl)pyridine-3-carbaldehyde, with the CAS number 124863-83-8, is a complex organic compound characterized by its pyridine core, which is substituted with various functional groups. The presence of a carbaldehyde group indicates that it contains an aldehyde functional group, contributing to its reactivity and potential applications in organic synthesis. The tert-butyl(dimethyl)silyl group enhances the compound's stability and solubility, making it useful in various chemical reactions, particularly in protecting groups during synthesis. The fluorophenyl substituent may impart unique electronic properties, influencing the compound's behavior in biological or chemical systems. Additionally, the presence of isopropyl groups suggests steric hindrance, which can affect the compound's interactions with other molecules. Overall, this substance is likely to be of interest in medicinal chemistry and materials science due to its structural complexity and potential functional properties.
Formula:C25H36FNO2Si
InChI:InChI=1/C25H36FNO2Si/c1-16(2)23-20(14-28)22(18-10-12-19(26)13-11-18)21(24(27-23)17(3)4)15-29-30(8,9)25(5,6)7/h10-14,16-17H,15H2,1-9H3
SMILES:CC(C)c1c(C=O)c(c2ccc(cc2)F)c(CO[Si](C)(C)C(C)(C)C)c(C(C)C)n1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
3-Pyridinecarboxaldehyde, 5-[[[(1,1-dimethylethyl)dimethylsilyl]oxy]methyl]-4-(4-fluorophenyl)-2,6-bis(1-methylethyl)-
CAS:Formula:C25H36FNO2SiColor and Shape:SolidMolecular weight:429.6427
