
CAS 124869-11-0
:1,2,5-Naphthalenetrimethanol, 1,4,4a,5,6,7,8,8a-octahydro-5,8a-dimethyl-, [1R-(1α,4aβ,5α,8aα)]-
Description:
1,2,5-Naphthalenetrimethanol, specifically the compound with the designation 1,4,4a,5,6,7,8,8a-octahydro-5,8a-dimethyl- and the stereochemical configuration [1R-(1α,4aβ,5α,8aα)], is a complex organic molecule characterized by its polycyclic structure derived from naphthalene. This compound features multiple hydroxyl (-OH) groups, which contribute to its potential as a polyalcohol and influence its solubility and reactivity. The presence of multiple chiral centers indicates that it can exist in various stereoisomeric forms, which may exhibit different physical and chemical properties. The octahydro structure suggests that it is a saturated derivative, likely resulting in a relatively high boiling point and low volatility. Additionally, the dimethyl substitution indicates that it may have unique steric and electronic properties, affecting its interactions in chemical reactions. This compound may find applications in fields such as pharmaceuticals, materials science, or as a building block in organic synthesis, although specific applications would depend on further research into its properties and behavior.
Formula:C15H26O3
InChI:InChI=1S/C15H26O3/c1-14(10-18)6-3-7-15(2)12(9-17)11(8-16)4-5-13(14)15/h4,12-13,16-18H,3,5-10H2,1-2H3/t12-,13-,14+,15+/m0/s1
InChI key:InChIKey=ZVTXMJUNGOWZRE-BYNSBNAKSA-N
SMILES:C[C@@]12[C@]([C@](CO)(C)CCC1)(CC=C(CO)[C@@H]2CO)[H]
Synonyms:- 1,2,5-Naphthalenetrimethanol, 1,4,4a,5,6,7,8,8a-octahydro-5,8a-dimethyl-, [1R-(1α,4aβ,5α,8aα)]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
7-Drimene-11,12,14-triol
CAS:7-Drimene-11,12,14-triol is a natural product that can be used as a reference standard. The CAS number of 7-Drimene-11,12,14-triol is 124869-11-0.Formula:C15H26O3Color and Shape:SolidMolecular weight:254.37
