CAS 1248723-39-8

1-(Cyclobutylamino)-2-propanol

Description:

1-(Cyclobutylamino)-2-propanol is an organic compound characterized by the presence of a cyclobutyl group attached to an amino group, which is further connected to a propanol moiety. This compound features a secondary amine due to the presence of the cyclobutyl group bonded to the nitrogen atom. The structure includes a hydroxyl (-OH) group, which contributes to its classification as an alcohol. The presence of both the amino and hydroxyl functional groups suggests potential for hydrogen bonding, influencing its solubility and reactivity. Typically, compounds like this may exhibit biological activity, making them of interest in medicinal chemistry. The cyclobutyl ring can impart unique steric and electronic properties, potentially affecting the compound's interaction with biological targets. Additionally, the compound's physical properties, such as boiling point and melting point, would be influenced by its molecular weight and functional groups. Overall, 1-(Cyclobutylamino)-2-propanol represents a versatile structure with potential applications in various chemical and pharmaceutical contexts.

Formula: C₇H₁₅NO

InChI: InChI=1S/C7H15NO/c1-6(9)5-8-7-3-2-4-7/h6-9H,2-5H2,1H3

InChI key: InChIKey=AXIOIFOROCMGMP-UHFFFAOYSA-N

SMILES: N(CC(C)O)C1CCC1

Synonyms:

• 1-(Cyclobutylamino)-2-propanol
• 2-Propanol, 1-(cyclobutylamino)-