CAS 1248738-16-0

Tetrahydro-4-(methylthio)-2H-pyran-4-carboxylic acid

Description:

Tetrahydro-4-(methylthio)-2H-pyran-4-carboxylic acid is a chemical compound characterized by its unique structure, which includes a tetrahydropyran ring and a carboxylic acid functional group. The presence of a methylthio group contributes to its reactivity and potential applications in organic synthesis. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is soluble in polar solvents, which enhances its utility in various chemical reactions. The carboxylic acid moiety allows for hydrogen bonding, making it a potential candidate for interactions in biological systems or as a building block in pharmaceuticals. Its CAS number, 1248738-16-0, is a unique identifier that facilitates the tracking and study of this compound in scientific literature and databases. Overall, Tetrahydro-4-(methylthio)-2H-pyran-4-carboxylic acid is of interest for its structural features and potential applications in medicinal chemistry and organic synthesis.

Formula: C₇H₁₂O₃S

InChI: InChI=1S/C7H12O3S/c1-11-7(6(8)9)2-4-10-5-3-7/h2-5H2,1H3,(H,8,9)

InChI key: InChIKey=FXDSQCONZZGYOY-UHFFFAOYSA-N

SMILES: C(O)(=O)C1(SC)CCOCC1

Synonyms:

• 2H-Pyran-4-carboxylic acid, tetrahydro-4-(methylthio)-
• Tetrahydro-4-(methylthio)-2H-pyran-4-carboxylic acid