CAS 1248810-05-0

3-Chloro-4-(cyclopropylmethoxy)benzenemethanamine

Description:

3-Chloro-4-(cyclopropylmethoxy)benzenemethanamine is an organic compound characterized by its complex structure, which includes a chlorobenzene ring substituted with a cyclopropylmethoxy group and an amine functional group. The presence of the chlorine atom introduces electronegativity, influencing the compound's reactivity and solubility. The cyclopropylmethoxy group contributes to the compound's steric and electronic properties, potentially affecting its interaction with biological targets. As an amine, it may exhibit basicity and can participate in hydrogen bonding, which is significant for its solubility in polar solvents and its potential biological activity. The compound's unique structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. However, specific data regarding its physical properties, such as melting point, boiling point, and solubility, would require empirical investigation or literature references. Overall, the characteristics of this compound make it a subject of interest for further research in organic synthesis and drug development.

Formula: C₁₁H₁₄ClNO

InChI: InChI=1S/C11H14ClNO/c12-10-5-9(6-13)3-4-11(10)14-7-8-1-2-8/h3-5,8H,1-2,6-7,13H2

InChI key: InChIKey=QHKORSJTGMTROE-UHFFFAOYSA-N

SMILES: O(CC1CC1)C2=C(Cl)C=C(CN)C=C2

Synonyms:

• 3-Chloro-4-(cyclopropylmethoxy)benzenemethanamine
• Benzenemethanamine, 3-chloro-4-(cyclopropylmethoxy)-