CAS 124883-30-3
:Sulfonium, ethyldimethyl-, acetate (1:1)
Description:
Ethyldimethylsulfonium acetate, with the CAS number 124883-30-3, is a quaternary ammonium compound characterized by its sulfonium ion structure. This substance typically appears as a colorless to pale yellow liquid and is soluble in polar solvents due to its ionic nature. Ethyldimethylsulfonium acetate is known for its role as a reagent in organic synthesis, particularly in reactions involving nucleophilic substitutions and as a catalyst in various chemical processes. Its acetate component contributes to its stability and reactivity, making it useful in applications such as ionic liquids and in the synthesis of other organic compounds. The compound is generally handled with care, as quaternary ammonium compounds can exhibit antimicrobial properties and may pose environmental concerns if not managed properly. Safety data sheets should be consulted for specific handling and disposal guidelines. Overall, ethyldimethylsulfonium acetate is a versatile chemical with applications in both research and industrial settings.
Formula:C4H11S·C2H3O2
InChI:InChI=1S/C4H11S.C2H4O2/c1-4-5(2)3;1-2(3)4/h4H2,1-3H3;1H3,(H,3,4)/q+1;/p-1
InChI key:InChIKey=NYFJBLXNPZUEEB-UHFFFAOYSA-M
SMILES:[S+](CC)(C)C.C(C)([O-])=O
Synonyms:- Sulfonium, ethyldimethyl-, acetate
- Ethyldimethylsulfonium acetate
- Sulfonium, ethyldimethyl-, acetate (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
