CymitQuimica logo

CAS 124884-02-2

:

N-[5-(1,3-Dioxolan-2-yl)pentyl]-2,2,2-trifluoroacetamide

Description:
N-[5-(1,3-Dioxolan-2-yl)pentyl]-2,2,2-trifluoroacetamide is a chemical compound characterized by its unique structure, which includes a dioxolane ring and a trifluoroacetamide functional group. The presence of the dioxolane moiety suggests that it may exhibit properties such as increased solubility in polar solvents and potential reactivity due to the ring's electron-rich nature. The trifluoroacetamide group contributes to the compound's stability and may enhance its lipophilicity, making it relevant in various applications, including pharmaceuticals and agrochemicals. This compound is likely to be a solid or liquid at room temperature, depending on its molecular weight and intermolecular interactions. Its trifluoromethyl group can impart unique electronic properties, influencing its reactivity and interactions with biological targets. Additionally, the compound may exhibit specific biological activities, which could be of interest in medicinal chemistry. Safety and handling precautions should be observed, as with any chemical substance, particularly those containing fluorinated groups, which can pose environmental and health risks.
Formula:C10H16F3NO3
InChI:InChI=1S/C10H16F3NO3/c11-10(12,13)9(15)14-5-3-1-2-4-8-16-6-7-17-8/h8H,1-7H2,(H,14,15)
InChI key:InChIKey=PHORFPKCEYQGDL-UHFFFAOYSA-N
SMILES:C(CCCCNC(C(F)(F)F)=O)C1OCCO1
Synonyms:
  • N-[5-(1,3-Dioxolan-2-yl)pentyl]-2,2,2-trifluoroacetamide
  • Acetamide, N-[5-(1,3-dioxolan-2-yl)pentyl]-2,2,2-trifluoro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.