
CAS 124886-03-9
:(2-Phenyl-1H-inden-1-yl)lithium
Description:
(2-Phenyl-1H-inden-1-yl)lithium is an organolithium compound characterized by its unique structure, which features a lithium atom bonded to a phenyl-substituted indene moiety. This compound is typically a colorless to pale yellow solid and is known for its high reactivity, particularly as a strong nucleophile and base. It is often used in organic synthesis, particularly in the formation of carbon-carbon bonds through nucleophilic addition reactions. The presence of the indene structure contributes to its stability and reactivity, allowing it to participate in various chemical transformations. As with many organolithium compounds, it must be handled with care due to its sensitivity to moisture and air, which can lead to decomposition. Additionally, it is important to note that (2-Phenyl-1H-inden-1-yl)lithium should be stored under inert atmosphere conditions to maintain its integrity and reactivity for synthetic applications.
Formula:C15H11Li
InChI:InChI=1S/C15H11.Li/c1-2-6-12(7-3-1)15-10-13-8-4-5-9-14(13)11-15;/h1-11H;
InChI key:InChIKey=YENRABKYXALERP-UHFFFAOYSA-N
SMILES:[Li]C1C(=CC=2C1=CC=CC2)C3=CC=CC=C3
Synonyms:- (2-Phenyl-1H-inden-1-yl)lithium
- Lithium, (2-phenyl-1H-inden-1-yl)-
- 1H-Indene, 2-phenyl-, lithium complex
- (2-Phenylindenyl)lithium
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
