CAS 1248907-30-3
:5-(3-Cyclohexen-1-yl)-1,3,4-oxadiazol-2-amine
Description:
5-(3-Cyclohexen-1-yl)-1,3,4-oxadiazol-2-amine is a chemical compound characterized by its unique structural features, which include a cyclohexene ring and an oxadiazole moiety. The presence of the oxadiazole ring contributes to its potential as a bioactive molecule, often associated with various pharmacological activities. The amine functional group enhances its reactivity and solubility in polar solvents, making it suitable for various chemical reactions and applications. This compound may exhibit interesting properties such as antimicrobial, anti-inflammatory, or anticancer activities, although specific biological data would depend on empirical studies. Its molecular structure suggests potential for interactions with biological targets, which could be explored in medicinal chemistry. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, 5-(3-Cyclohexen-1-yl)-1,3,4-oxadiazol-2-amine represents a class of compounds that could be of interest in both synthetic and medicinal chemistry research.
Formula:C8H11N3O
InChI:InChI=1S/C8H11N3O/c9-8-11-10-7(12-8)6-4-2-1-3-5-6/h1-2,6H,3-5H2,(H2,9,11)
InChI key:InChIKey=UVIGTGJSSFKAIR-UHFFFAOYSA-N
SMILES:NC=1OC(=NN1)C2CCC=CC2
Synonyms:- 1,3,4-Oxadiazol-2-amine, 5-(3-cyclohexen-1-yl)-
- 5-(3-Cyclohexen-1-yl)-1,3,4-oxadiazol-2-amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.