CymitQuimica logo

CAS 1248907-52-9

:

5-(3-Azetidinyl)-3-(3-methylphenyl)-1,2,4-oxadiazole

Description:
5-(3-Azetidinyl)-3-(3-methylphenyl)-1,2,4-oxadiazole is a chemical compound characterized by its unique structure, which includes an oxadiazole ring fused with an azetidine moiety and a substituted phenyl group. The oxadiazole ring contributes to its potential biological activity, as compounds containing this heterocyclic structure are often investigated for their pharmacological properties. The presence of the azetidine ring may influence the compound's interaction with biological targets, potentially enhancing its efficacy. Additionally, the 3-methylphenyl substituent can affect the compound's lipophilicity and solubility, which are critical factors in drug design and development. The compound's molecular properties, such as its melting point, boiling point, and solubility, would be essential for understanding its behavior in various environments. Overall, this compound may have applications in medicinal chemistry, particularly in the development of new therapeutic agents, although specific biological activities would require further investigation through experimental studies.
Formula:C12H13N3O
InChI:InChI=1S/C12H13N3O/c1-8-3-2-4-9(5-8)11-14-12(16-15-11)10-6-13-7-10/h2-5,10,13H,6-7H2,1H3
InChI key:InChIKey=KCFPETCSEALGPN-UHFFFAOYSA-N
SMILES:CC=1C=C(C=2N=C(ON2)C3CNC3)C=CC1
Synonyms:
  • 1,2,4-Oxadiazole, 5-(3-azetidinyl)-3-(3-methylphenyl)-
  • 5-(3-Azetidinyl)-3-(3-methylphenyl)-1,2,4-oxadiazole
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.