CAS 1248907-60-9

2-[(4,6-Dimethyl-2-pyrimidinyl)amino]-4-thiazoleacetic acid

Description:

2-[(4,6-Dimethyl-2-pyrimidinyl)amino]-4-thiazoleacetic acid is a chemical compound characterized by its unique structural features, which include a thiazole ring and a pyrimidine moiety. This compound typically exhibits properties associated with both acidic and basic functional groups, allowing it to participate in various chemical reactions. The presence of the thiazole and pyrimidine rings suggests potential biological activity, as these heterocycles are often found in pharmaceuticals and agrochemicals. The dimethyl substitution on the pyrimidine ring can influence the compound's solubility, stability, and interaction with biological targets. Additionally, the carboxylic acid group in the thiazoleacetic acid portion contributes to its acidity and potential for forming salts or esters. Overall, this compound may be of interest in medicinal chemistry and research due to its structural complexity and potential applications in drug development or as a biochemical probe. Further studies would be necessary to fully elucidate its properties and potential uses.

Formula: C₁₁H₁₂N₄O₂S

InChI: InChI=1S/C11H12N4O2S/c1-6-3-7(2)13-10(12-6)15-11-14-8(5-18-11)4-9(16)17/h3,5H,4H2,1-2H3,(H,16,17)(H,12,13,14,15)

InChI key: InChIKey=SJIIQOZLPDUZPZ-UHFFFAOYSA-N

SMILES: N(C1=NC(CC(O)=O)=CS1)C=2N=C(C)C=C(C)N2

Synonyms:

• 4-Thiazoleacetic acid, 2-[(4,6-dimethyl-2-pyrimidinyl)amino]-
• 2-[(4,6-Dimethyl-2-pyrimidinyl)amino]-4-thiazoleacetic acid