CymitQuimica logo

CAS 1248907-65-4

:

1-Cyclopropyl-3-(2-fluorophenyl)piperazine

Description:
1-Cyclopropyl-3-(2-fluorophenyl)piperazine is a chemical compound characterized by its unique structure, which includes a piperazine ring substituted with a cyclopropyl group and a 2-fluorophenyl group. This compound typically exhibits properties associated with piperazine derivatives, such as potential psychoactive effects and interactions with various neurotransmitter receptors, particularly in the central nervous system. The presence of the cyclopropyl group can influence the compound's conformational flexibility and steric properties, while the 2-fluorophenyl moiety may enhance lipophilicity and alter binding affinity to biological targets. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. Additionally, the fluorine atom can enhance metabolic stability and influence pharmacokinetic properties. As with many piperazine derivatives, the compound may be of interest in research related to anxiety, depression, or other neuropsychiatric disorders. However, specific biological activity and safety profiles would require further investigation through experimental studies.
Formula:C13H17FN2
InChI:InChI=1S/C13H17FN2/c14-12-4-2-1-3-11(12)13-9-16(8-7-15-13)10-5-6-10/h1-4,10,13,15H,5-9H2
InChI key:InChIKey=RIBQZXKPGOLJEX-UHFFFAOYSA-N
SMILES:FC1=C(C2CN(CCN2)C3CC3)C=CC=C1
Synonyms:
  • 1-Cyclopropyl-3-(2-fluorophenyl)piperazine
  • Piperazine, 1-cyclopropyl-3-(2-fluorophenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.