CAS 1248908-14-6
:3-(4-Chlorophenyl)-1-cyclopropylpiperazine
Description:
3-(4-Chlorophenyl)-1-cyclopropylpiperazine is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. The presence of a cyclopropyl group and a 4-chlorophenyl substituent contributes to its unique properties. This compound is often studied for its potential pharmacological activities, particularly in the context of neuropharmacology, as piperazine derivatives can interact with various neurotransmitter systems. The chlorophenyl group may enhance lipophilicity, potentially affecting the compound's bioavailability and receptor binding affinity. Additionally, the cyclopropyl moiety can influence the compound's conformational flexibility and steric properties. As with many piperazine derivatives, it may exhibit activity as an anxiolytic, antidepressant, or antipsychotic agent, although specific biological activities would depend on further empirical studies. Safety and handling precautions are essential, as with all chemical substances, due to potential toxicity or reactivity.
Formula:C13H17ClN2
InChI:InChI=1S/C13H17ClN2/c14-11-3-1-10(2-4-11)13-9-16(8-7-15-13)12-5-6-12/h1-4,12-13,15H,5-9H2
InChI key:InChIKey=QQIAGCJMLMLXHR-UHFFFAOYSA-N
SMILES:ClC1=CC=C(C2CN(CCN2)C3CC3)C=C1
Synonyms:- 3-(4-Chlorophenyl)-1-cyclopropylpiperazine
- Piperazine, 3-(4-chlorophenyl)-1-cyclopropyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.