CymitQuimica logo

CAS 1248965-64-1

:

4-[(1-Oxido-4-thiomorpholinyl)methyl]benzenemethanamine

Description:
4-[(1-Oxido-4-thiomorpholinyl)methyl]benzenemethanamine, identified by its CAS number 1248965-64-1, is a chemical compound that features a complex structure incorporating both aromatic and heterocyclic components. The presence of a thiomorpholine ring suggests that it possesses sulfur in its structure, which can influence its reactivity and interaction with biological systems. The oxido group indicates the presence of an oxygen atom, likely contributing to the compound's polarity and potential solubility in various solvents. This compound may exhibit properties typical of amines, such as basicity and the ability to form hydrogen bonds, which can affect its biological activity and pharmacological profile. Its unique structure may allow for specific interactions with biological targets, making it of interest in medicinal chemistry and drug development. However, detailed studies would be necessary to fully understand its physical and chemical properties, including stability, reactivity, and potential applications in various fields.
Formula:C12H18N2OS
InChI:InChI=1S/C12H18N2OS/c13-9-11-1-3-12(4-2-11)10-14-5-7-16(15)8-6-14/h1-4H,5-10,13H2
InChI key:InChIKey=OQLHOCAPLKEYJL-UHFFFAOYSA-N
SMILES:C(C1=CC=C(CN)C=C1)N2CCS(=O)CC2
Synonyms:
  • Benzenemethanamine, 4-[(1-oxido-4-thiomorpholinyl)methyl]-
  • 4-[(1-Oxido-4-thiomorpholinyl)methyl]benzenemethanamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.