CAS 124907-01-3

8-Fluoro-1,2,3,9-tetrahydro-9-methyl-4H-carbazol-4-one

Description:

8-Fluoro-1,2,3,9-tetrahydro-9-methyl-4H-carbazol-4-one is a chemical compound characterized by its unique structure, which includes a carbazole core modified with a fluorine atom and a ketone functional group. This compound features a tetrahydro configuration, indicating the presence of a saturated ring system, which contributes to its stability and reactivity. The fluorine substitution at the 8-position enhances its lipophilicity and may influence its biological activity, making it of interest in medicinal chemistry. The methyl group at the 9-position further modifies its electronic properties and steric hindrance. This compound is typically studied for its potential applications in pharmaceuticals, particularly in the development of drugs targeting various biological pathways. Its specific interactions and reactivity can be influenced by the presence of the fluorine atom, which can affect hydrogen bonding and molecular interactions. Overall, 8-Fluoro-1,2,3,9-tetrahydro-9-methyl-4H-carbazol-4-one represents a class of compounds that may exhibit interesting pharmacological properties due to their structural characteristics.

Formula: C₁₃H₁₂FNO

InChI: InChI=1S/C13H12FNO/c1-15-10-6-3-7-11(16)12(10)8-4-2-5-9(14)13(8)15/h2,4-5H,3,6-7H2,1H3

InChI key: InChIKey=ZXQNFANRYNKZMJ-UHFFFAOYSA-N

SMILES: O=C1C=2C=3C(N(C)C2CCC1)=C(F)C=CC3

Synonyms:

• 8-Fluoro-1,2,3,9-tetrahydro-9-methyl-4H-carbazol-4-one
• 4H-Carbazol-4-one, 8-fluoro-1,2,3,9-tetrahydro-9-methyl-

4H-Carbazol-4-one, 8-fluoro-1,2,3,9-tetrahydro-9-methyl-

CAS: 124907-01-3

Formula: C₁₃H₁₂FNO

Molecular weight: 217.2389

Ref: IN-DA000MVY