CAS 1249109-10-1

3-Chloro-4-fluoro-N-(2-methoxy-1-methylethyl)benzenemethanamine

Description:

3-Chloro-4-fluoro-N-(2-methoxy-1-methylethyl)benzenemethanamine is a chemical compound characterized by its aromatic structure, which includes a benzene ring substituted with a chlorine atom at the 3-position and a fluorine atom at the 4-position. The compound features an amine functional group, specifically a benzenemethanamine, which contributes to its reactivity and potential applications in medicinal chemistry. The presence of the methoxy group and the branched alkyl chain (2-methoxy-1-methylethyl) enhances its lipophilicity, potentially influencing its biological activity and solubility in organic solvents. This compound may exhibit interesting pharmacological properties, making it a candidate for further research in drug development. Its molecular structure suggests potential interactions with biological targets, which could be explored in various therapeutic contexts. As with many halogenated compounds, it is essential to consider its environmental impact and stability under different conditions. Safety data and handling precautions should be observed due to the presence of halogens and amine functionalities.

Formula: C₁₁H₁₅ClFNO

InChI: InChI=1S/C11H15ClFNO/c1-8(7-15-2)14-6-9-3-4-11(13)10(12)5-9/h3-5,8,14H,6-7H2,1-2H3

InChI key: InChIKey=BPSOBIBNNAOLDN-UHFFFAOYSA-N

SMILES: C(NC(COC)C)C1=CC(Cl)=C(F)C=C1

Synonyms:

• 3-Chloro-4-fluoro-N-(2-methoxy-1-methylethyl)benzenemethanamine
• Benzenemethanamine, 3-chloro-4-fluoro-N-(2-methoxy-1-methylethyl)-