CAS 1249147-56-5
:4-(Cyclobutylamino)cyclohexanol
Description:
4-(Cyclobutylamino)cyclohexanol is an organic compound characterized by its cyclohexanol backbone substituted with a cyclobutylamino group. This structure imparts unique properties, including potential applications in medicinal chemistry due to its ability to interact with biological targets. The presence of both cycloalkane rings contributes to its rigidity and steric hindrance, which can influence its pharmacokinetic properties, such as solubility and permeability. The amino group may also participate in hydrogen bonding, enhancing its interactions with other molecules. As a secondary amine, it can act as a nucleophile in various chemical reactions. The compound's specific stereochemistry and functional groups can affect its reactivity and biological activity, making it a subject of interest in drug design and development. Additionally, its relatively low molecular weight and moderate polarity suggest that it may exhibit favorable characteristics for oral bioavailability. Overall, 4-(Cyclobutylamino)cyclohexanol represents a versatile scaffold for further exploration in chemical and pharmaceutical research.
Formula:C10H19NO
InChI:InChI=1S/C10H19NO/c12-10-6-4-9(5-7-10)11-8-2-1-3-8/h8-12H,1-7H2
InChI key:InChIKey=HXGVTWQYVWYFOD-UHFFFAOYSA-N
SMILES:N(C1CCC(O)CC1)C2CCC2
Synonyms:- 4-(Cyclobutylamino)cyclohexanol
- Cyclohexanol, 4-(cyclobutylamino)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.