CAS 1249151-02-7

1-(1H-Pyrazol-4-yl)piperazine

Description:

1-(1H-Pyrazol-4-yl)piperazine is a chemical compound characterized by its unique structure, which includes a piperazine ring and a pyrazole moiety. The piperazine ring contributes to its potential as a pharmacological agent, often enhancing solubility and bioavailability. The presence of the pyrazole group can impart specific biological activities, making it of interest in medicinal chemistry. This compound is typically a solid at room temperature and may exhibit moderate to high polarity due to the presence of nitrogen atoms in both the piperazine and pyrazole rings. Its molecular interactions can be influenced by hydrogen bonding and dipole-dipole interactions, which are significant in biological systems. The compound may also demonstrate potential as a ligand in coordination chemistry or as a precursor in the synthesis of more complex molecules. Safety data and handling precautions should be observed, as with any chemical substance, to mitigate risks associated with its use in laboratory or industrial settings.

Formula: C₇H₁₂N₄

InChI: InChI=1S/C7H12N4/c1-3-11(4-2-8-1)7-5-9-10-6-7/h5-6,8H,1-4H2,(H,9,10)

InChI key: InChIKey=FILWPDPGRBPZDL-UHFFFAOYSA-N

SMILES: C=1(C=NNC1)N2CCNCC2

Synonyms:

• Piperazine, 1-(1H-pyrazol-4-yl)-
• 1-(1H-Pyrazol-4-yl)piperazine