CymitQuimica logo

CAS 1249212-62-1

:

4-Bromo-1-(3-pyridinylmethyl)-1H-pyrazol-3-amine

Description:
4-Bromo-1-(3-pyridinylmethyl)-1H-pyrazol-3-amine is a chemical compound characterized by its unique structure, which includes a pyrazole ring substituted with a bromine atom and a pyridinylmethyl group. This compound typically exhibits properties associated with both heterocyclic and aromatic systems, contributing to its potential biological activity. The presence of the bromine atom may enhance its reactivity and influence its interaction with biological targets. The pyridine moiety can provide additional hydrogen bonding capabilities and may play a role in the compound's solubility and stability. As a pyrazole derivative, it may exhibit various pharmacological properties, making it of interest in medicinal chemistry. The compound's molecular structure suggests potential applications in drug development, particularly in areas targeting specific receptors or enzymes. However, detailed studies on its biological activity, toxicity, and pharmacokinetics would be necessary to fully understand its potential uses and safety profile.
Formula:C9H9BrN4
InChI:InChI=1S/C9H9BrN4/c10-8-6-14(13-9(8)11)5-7-2-1-3-12-4-7/h1-4,6H,5H2,(H2,11,13)
InChI key:InChIKey=NKODKXMPVSZLLQ-UHFFFAOYSA-N
SMILES:C(N1C=C(Br)C(N)=N1)C=2C=CC=NC2
Synonyms:
  • 4-Bromo-1-(3-pyridinylmethyl)-1H-pyrazol-3-amine
  • 1H-Pyrazol-3-amine, 4-bromo-1-(3-pyridinylmethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.