CAS 124929-08-4
:2,3-dimethoxy-5-iodo-N-((1-(4'-fluorobenzyl)-2-pyrrolidinyl)methyl)benzamide
Description:
2,3-Dimethoxy-5-iodo-N-((1-(4'-fluorobenzyl)-2-pyrrolidinyl)methyl)benzamide is a complex organic compound characterized by its multi-functional structure, which includes a benzamide core substituted with methoxy and iodo groups, as well as a pyrrolidine moiety. The presence of the methoxy groups contributes to its solubility and potential reactivity, while the iodine atom may enhance its biological activity or facilitate certain chemical reactions. The fluorobenzyl group attached to the pyrrolidine ring can influence the compound's lipophilicity and binding affinity to biological targets. This compound may exhibit pharmacological properties, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. Its specific interactions and effects would depend on its molecular conformation and the presence of functional groups, which can affect its behavior in biological systems. As with many complex organic molecules, understanding its characteristics requires consideration of its synthesis, stability, and potential applications in drug development or other fields.
Formula:C21H24F123IN2O3
InChI:InChI=1/C21H24FIN2O3/c1-27-19-11-16(23)10-18(20(19)28-2)21(26)24-12-17-4-3-9-25(17)13-14-5-7-15(22)8-6-14/h5-8,10-11,17H,3-4,9,12-13H2,1-2H3,(H,24,26)/t17-/m1/s1/i23-4
SMILES:COc1cc(cc(c1OC)C(=NC[C@H]1CCCN1Cc1ccc(cc1)F)O)[123I]
Synonyms:- Fida2
- (R)-N-((1-((4-Fluorophenyl)methyl)-2-pyrrolidinyl)methyl)-5-(iodo-123I)-2,3-dimethoxybenzamide
- Benzamide, N-((1-((4-fluorophenyl)methyl)-2-pyrrolidinyl)methyl)-5-(iodo-123I)-2,3-dimethoxy-, (R)-
- N-{[(2R)-1-(4-fluorobenzyl)pyrrolidin-2-yl]methyl}-5-(~123~I)iodo-2,3-dimethoxybenzamide
- 2,3-Dimethoxy-5-iodo-N-((1-(4'-fluorobenzyl)-2-pyrrolidinyl)methyl)benzamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Benzamide, N-[[1-[(4-fluorophenyl)methyl]-2-pyrrolidinyl]methyl]-5-(iodo-123I)-2,3-dimethoxy-, (R)- (9CI)
CAS:Formula:C21H24FIN2O3Molecular weight:498.3297
