CAS 124930-94-5
:8-Chloro-2-(4-chlorophenyl)-4-quinolinecarbonyl chloride
Description:
8-Chloro-2-(4-chlorophenyl)-4-quinolinecarbonyl chloride is a synthetic organic compound characterized by its complex structure, which includes a quinoline moiety and multiple chlorine substituents. This compound features a carbonyl chloride functional group, making it a reactive acyl chloride, which can participate in various chemical reactions, particularly acylation. The presence of chlorine atoms enhances its electrophilic nature, potentially increasing its reactivity towards nucleophiles. The quinoline structure contributes to its aromatic properties and may influence its biological activity, making it of interest in medicinal chemistry. This compound may be utilized in the synthesis of other chemical entities or as an intermediate in pharmaceutical development. Its specific applications and biological activities would depend on further studies, including its interaction with biological targets. As with many chlorinated compounds, handling precautions are necessary due to potential toxicity and environmental concerns.
Formula:C16H8Cl3NO
InChI:InChI=1S/C16H8Cl3NO/c17-10-6-4-9(5-7-10)14-8-12(16(19)21)11-2-1-3-13(18)15(11)20-14/h1-8H
InChI key:InChIKey=ZNSCSHFAMPVYEO-UHFFFAOYSA-N
SMILES:C(Cl)(=O)C=1C2=C(N=C(C1)C3=CC=C(Cl)C=C3)C(Cl)=CC=C2
Synonyms:- 8-Chloro-2-(4-chlorophenyl)-4-quinolinecarbonyl chloride
- Cinchoninoyl chloride, 8-chloro-2-(p-chlorophenyl)-
- NSC 39979
- 4-Quinolinecarbonyl chloride, 8-chloro-2-(4-chlorophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.