
CAS 1249312-22-8
:3-[(2-Bromo-1-phenylethoxy)methyl]tetrahydrofuran
Description:
3-[(2-Bromo-1-phenylethoxy)methyl]tetrahydrofuran is an organic compound characterized by its tetrahydrofuran ring, which is a five-membered cyclic ether known for its polar aprotic solvent properties. The presence of the 2-bromo-1-phenylethoxy group introduces both bromine and phenyl functionalities, which can influence the compound's reactivity and solubility. The bromine atom may participate in nucleophilic substitution reactions, while the phenyl group can provide aromatic stability and affect the compound's electronic properties. This compound is likely to exhibit moderate to high lipophilicity due to the hydrophobic nature of the phenyl group, which may impact its biological activity and interactions in various chemical environments. Additionally, the tetrahydrofuran moiety contributes to the compound's potential as a solvent or reagent in organic synthesis. Overall, the unique combination of functional groups in 3-[(2-Bromo-1-phenylethoxy)methyl]tetrahydrofuran suggests diverse applications in medicinal chemistry and materials science.
Formula:C13H17BrO2
InChI:InChI=1S/C13H17BrO2/c14-8-13(12-4-2-1-3-5-12)16-10-11-6-7-15-9-11/h1-5,11,13H,6-10H2
InChI key:InChIKey=HKKMAPRSSOKMIA-UHFFFAOYSA-N
SMILES:C(OCC1CCOC1)(CBr)C2=CC=CC=C2
Synonyms:- 3-[(2-Bromo-1-phenylethoxy)methyl]tetrahydrofuran
- Furan, 3-[(2-bromo-1-phenylethoxy)methyl]tetrahydro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.