CAS 1249362-85-3

Cyclopropyl[2-hydroxy-5-(2-methoxyethyl)phenyl]methanone

Description:

Cyclopropyl[2-hydroxy-5-(2-methoxyethyl)phenyl]methanone, identified by its CAS number 1249362-85-3, is an organic compound characterized by its unique structural features. It contains a cyclopropyl group, which is a three-membered carbon ring known for its strain and reactivity. The compound also features a phenolic moiety with a hydroxyl group and a methoxyethyl substituent, contributing to its potential solubility and reactivity in various chemical environments. The presence of the ketone functional group (methanone) indicates that it can participate in nucleophilic addition reactions. This compound may exhibit interesting biological activities due to its structural complexity, making it a candidate for further research in medicinal chemistry. Its properties, such as melting point, boiling point, and solubility, would depend on the specific interactions of its functional groups and the overall molecular structure. As with many organic compounds, safety data and handling precautions should be considered when working with this substance in a laboratory setting.

Formula: C₁₃H₁₆O₃

InChI: InChI=1S/C13H16O3/c1-16-7-6-9-2-5-12(14)11(8-9)13(15)10-3-4-10/h2,5,8,10,14H,3-4,6-7H2,1H3

InChI key: InChIKey=ZXFJPLVRPPDILE-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(CCOC)=CC=C1O)C2CC2

Synonyms:

• Methanone, cyclopropyl[2-hydroxy-5-(2-methoxyethyl)phenyl]-
• Cyclopropyl[2-hydroxy-5-(2-methoxyethyl)phenyl]methanone