CAS 124937-73-1: 2-Methoxy-5-methyl-γ-phenylbenzenepropanol
Description:2-Methoxy-5-methyl-γ-phenylbenzenepropanol, identified by its CAS number 124937-73-1, is an organic compound characterized by its complex structure, which includes a methoxy group, a methyl group, and a phenyl group attached to a propanol backbone. This compound is likely to exhibit properties typical of aromatic alcohols, such as moderate solubility in organic solvents and potential reactivity due to the presence of hydroxyl (-OH) and ether (-O-) functional groups. The methoxy group can influence the compound's polarity and reactivity, while the phenyl group may contribute to its stability and aromatic characteristics. Additionally, the presence of multiple substituents can affect its physical properties, such as boiling point and melting point, as well as its potential applications in pharmaceuticals or as a chemical intermediate. Overall, the specific characteristics, including its reactivity and potential uses, would depend on the detailed molecular interactions and the environment in which it is studied.
Formula:C17H20O2
InChI:InChI=1S/C17H20O2/c1-13-8-9-17(19-2)16(12-13)15(10-11-18)14-6-4-3-5-7-14/h3-9,12,15,18H,10-11H2,1-2H3
InChI key:InChIKey=OCGTUTJXBDQGKL-UHFFFAOYSA-N
SMILES:OCCC(C=1C=CC=CC1)C2=CC(=CC=C2OC)C
- Synonyms:
- 2-Methoxy-5-methyl-γ-phenylbenzenepropanol
- 3-(2-Methoxy-5-Methylphenyl)-3-Phenylpropan-1-Ol
- 3-(2-Methoxy-5-methylphenyl)-3-phenylpropanol
- Benzenepropanol, 2-methoxy-5-methyl-γ-phenyl-