CymitQuimica logo

CAS 1249471-26-8

:

1-[(5-Methyl-2-thienyl)methyl]-3-pyrrolidinamine

Description:
1-[(5-Methyl-2-thienyl)methyl]-3-pyrrolidinamine, identified by its CAS number 1249471-26-8, is a chemical compound characterized by its unique structural features, which include a pyrrolidine ring and a thienyl group. The presence of the 5-methyl-2-thienyl moiety contributes to its potential biological activity, as thienyl compounds are often associated with various pharmacological properties. The pyrrolidine ring, a five-membered nitrogen-containing heterocycle, is known for its role in medicinal chemistry, often serving as a scaffold for drug development. This compound may exhibit properties such as solubility in organic solvents and potential interactions with biological targets, making it of interest in research contexts, particularly in the fields of medicinal chemistry and drug design. Its specific reactivity and interactions would depend on the functional groups present and the overall molecular conformation. As with many organic compounds, safety and handling precautions should be observed, particularly in laboratory settings.
Formula:C10H16N2S
InChI:InChI=1S/C10H16N2S/c1-8-2-3-10(13-8)7-12-5-4-9(11)6-12/h2-3,9H,4-7,11H2,1H3
InChI key:InChIKey=MBCRHRKHGADMRM-UHFFFAOYSA-N
SMILES:C(C1=CC=C(C)S1)N2CCC(N)C2
Synonyms:
  • 1-[(5-Methyl-2-thienyl)methyl]-3-pyrrolidinamine
  • 3-Pyrrolidinamine, 1-[(5-methyl-2-thienyl)methyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.