CymitQuimica logo

CAS 1249505-24-5

:

1-(Azidomethyl)-4-ethoxybenzene

Description:
1-(Azidomethyl)-4-ethoxybenzene is an organic compound characterized by the presence of an azide functional group (-N3) and an ethoxy group (-OCH2CH3) attached to a benzene ring. This compound features a benzyl structure where the azide group is substituted at the benzyl position, making it a potential candidate for various chemical reactions, particularly in click chemistry and organic synthesis. The ethoxy group contributes to its solubility in organic solvents and may influence its reactivity. The azide group is known for its ability to undergo thermal decomposition and participate in nucleophilic substitution reactions, making this compound useful in the synthesis of more complex molecules. Additionally, the presence of both the azide and ethoxy groups can impart unique electronic and steric properties, which may affect its behavior in chemical reactions. Safety precautions should be taken when handling this compound due to the potential hazards associated with azides, including their explosive nature under certain conditions.
Formula:C9H11N3O
InChI:InChI=1S/C9H11N3O/c1-2-13-9-5-3-8(4-6-9)7-11-12-10/h3-6H,2,7H2,1H3
InChI key:InChIKey=SZVDXYDRNCJVOL-UHFFFAOYSA-N
SMILES:C(N=[N+]=[N-])C1=CC=C(OCC)C=C1
Synonyms:
  • 1-(Azidomethyl)-4-ethoxybenzene
  • Benzene, 1-(azidomethyl)-4-ethoxy-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.